C22H33N5O2 — CID 138038376
N-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]-3-pyrrolidin-1-ylpyrrolidine-1-carboxamide (PubChem CID 138038376) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]-3-pyrrolidin-1-ylpyrrolidine-1-carboxamide.
| Compound Name | N-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]-3-pyrrolidin-1-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 138038376 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | N-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]-3-pyrrolidin-1-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(CCNC(=O)N1CCC(N2CCCC2)C1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H33N5O2/c28-21(26-16-14-25(15-17-26)19-6-2-1-3-7-19)8-10-23-22(29)27-13-9-20(18-27)24-11-4-5-12-24/h1-3,6-7,20H,4-5,8-18H2,(H,23,29) |
| InChIKey | HUCVYABXMMWGQP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |