C17H23ClN4O2 — CID 95713635
2-[(3S)-3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]-2-oxoacetamide (PubChem CID 95713635) has the molecular formula C17H23ClN4O2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 2-[(3S)-3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]-2-oxoacetamide.
| Compound Name | 2-[(3S)-3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 95713635 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[(3S)-3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]-2-oxoacetamide |
| SMILES | NC(=O)C(=O)N1CCC[C@H](N2CCN(c3cccc(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C17H23ClN4O2/c18-13-3-1-4-14(11-13)20-7-9-21(10-8-20)15-5-2-6-22(12-15)17(24)16(19)23/h1,3-4,11,15H,2,5-10,12H2,(H2,19,23)/t15-/m0/s1 |
| InChIKey | ZMLBYLDLWWYGJP-HNNXBMFYSA-N |
| XLogP | 0.94 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|