C19H27ClN4O — CID 95719083
(1-aminocyclopropyl)-[(3R)-3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]methanone (PubChem CID 95719083) has the molecular formula C19H27ClN4O and a molecular weight of 362.91 g/mol. Its IUPAC name is (1-aminocyclopropyl)-[(3R)-3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]methanone.
| Compound Name | (1-aminocyclopropyl)-[(3R)-3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95719083 |
| Molecular Formula | C19H27ClN4O |
| Molecular Weight | 362.91 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (1-aminocyclopropyl)-[(3R)-3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]methanone |
| SMILES | NC1(C(=O)N2CCC[C@@H](N3CCN(c4cccc(Cl)c4)CC3)C2)CC1 |
| InChI | InChI=1S/C19H27ClN4O/c20-15-3-1-4-16(13-15)22-9-11-23(12-10-22)17-5-2-8-24(14-17)18(25)19(21)6-7-19/h1,3-4,13,17H,2,5-12,14,21H2/t17-/m1/s1 |
| InChIKey | IQTRMCKIZGNTAT-QGZVFWFLSA-N |
| XLogP | 1.94 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.91 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |