C21H30FN3O2 — CID 95722350
[(3R)-3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-(1-hydroxycyclopentyl)methanone (PubChem CID 95722350) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is [(3R)-3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-(1-hydroxycyclopentyl)methanone.
| Compound Name | [(3R)-3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-(1-hydroxycyclopentyl)methanone |
|---|---|
| PubChem CID | 95722350 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | [(3R)-3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-(1-hydroxycyclopentyl)methanone |
| SMILES | O=C(N1CCC[C@@H](N2CCN(c3ccc(F)cc3)CC2)C1)C1(O)CCCC1 |
| InChI | InChI=1S/C21H30FN3O2/c22-17-5-7-18(8-6-17)23-12-14-24(15-13-23)19-4-3-11-25(16-19)20(26)21(27)9-1-2-10-21/h5-8,19,27H,1-4,9-16H2/t19-/m1/s1 |
| InChIKey | FBYBBURAYIJSPZ-LJQANCHMSA-N |
| XLogP | 2.24 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |