C18H24FN7O — CID 45211610
1-[3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 45211610) has the molecular formula C18H24FN7O and a molecular weight of 373.44 g/mol. Its IUPAC name is 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-2-(tetrazol-1-yl)ethanone.
| Compound Name | 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 45211610 |
| Molecular Formula | C18H24FN7O |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnnn1)N1CCCC(N2CCN(c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C18H24FN7O/c19-15-3-5-16(6-4-15)23-8-10-24(11-9-23)17-2-1-7-25(12-17)18(27)13-26-14-20-21-22-26/h3-6,14,17H,1-2,7-13H2 |
| InChIKey | CQFJANCXXVPMRD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |