C22H23F4N3O — CID 42241698
[(3S)-3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-(2,4,5-trifluorophenyl)methanone (PubChem CID 42241698) has the molecular formula C22H23F4N3O and a molecular weight of 421.44 g/mol. Its IUPAC name is [(3S)-3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-(2,4,5-trifluorophenyl)methanone.
| Compound Name | [(3S)-3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-(2,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 42241698 |
| Molecular Formula | C22H23F4N3O |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | [(3S)-3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-(2,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)cc1F)N1CCC[C@H](N2CCN(c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C22H23F4N3O/c23-15-3-5-16(6-4-15)27-8-10-28(11-9-27)17-2-1-7-29(14-17)22(30)18-12-20(25)21(26)13-19(18)24/h3-6,12-13,17H,1-2,7-11,14H2/t17-/m0/s1 |
| InChIKey | JVECWNBAQKCKTG-KRWDZBQOSA-N |
| XLogP | 3.67 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|