C23H35ClN4O — CID 45228263
[3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]-(1-ethylpiperidin-4-yl)methanone (PubChem CID 45228263) has the molecular formula C23H35ClN4O and a molecular weight of 419.01 g/mol. Its IUPAC name is [3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]-(1-ethylpiperidin-4-yl)methanone.
| Compound Name | [3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]-(1-ethylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 45228263 |
| Molecular Formula | C23H35ClN4O |
| Molecular Weight | 419.01 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | [3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]-(1-ethylpiperidin-4-yl)methanone |
| SMILES | CCN1CCC(C(=O)N2CCCC(N3CCN(c4cccc(Cl)c4)CC3)C2)CC1 |
| InChI | InChI=1S/C23H35ClN4O/c1-2-25-11-8-19(9-12-25)23(29)28-10-4-7-22(18-28)27-15-13-26(14-16-27)21-6-3-5-20(24)17-21/h3,5-6,17,19,22H,2,4,7-16,18H2,1H3 |
| InChIKey | UZXGJXPCGDHGIW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.01 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |