C22H24Cl2FN3O — CID 45231780
(3-chloro-4-fluorophenyl)-[3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]methanone (PubChem CID 45231780) has the molecular formula C22H24Cl2FN3O and a molecular weight of 436.36 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)-[3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-fluorophenyl)-[3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 45231780 |
| Molecular Formula | C22H24Cl2FN3O |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (3-chloro-4-fluorophenyl)-[3-[4-(3-chlorophenyl)piperazin-1-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)c(Cl)c1)N1CCCC(N2CCN(c3cccc(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C22H24Cl2FN3O/c23-17-3-1-4-18(14-17)26-9-11-27(12-10-26)19-5-2-8-28(15-19)22(29)16-6-7-21(25)20(24)13-16/h1,3-4,6-7,13-14,19H,2,5,8-12,15H2 |
| InChIKey | RKKQTUDCZVSKMH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |