C21H28ClN3S — CID 29029571
1-(3-chlorophenyl)-4-[(3R)-1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]piperazine (PubChem CID 29029571) has the molecular formula C21H28ClN3S and a molecular weight of 390.00 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[(3R)-1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]piperazine.
| Compound Name | 1-(3-chlorophenyl)-4-[(3R)-1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]piperazine |
|---|---|
| PubChem CID | 29029571 |
| Molecular Formula | C21H28ClN3S |
| Molecular Weight | 390.00 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[(3R)-1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]piperazine |
| SMILES | Cc1ccc(CN2CCC[C@@H](N3CCN(c4cccc(Cl)c4)CC3)C2)s1 |
| InChI | InChI=1S/C21H28ClN3S/c1-17-7-8-21(26-17)16-23-9-3-6-20(15-23)25-12-10-24(11-13-25)19-5-2-4-18(22)14-19/h2,4-5,7-8,14,20H,3,6,9-13,15-16H2,1H3/t20-/m1/s1 |
| InChIKey | YGPPJRLPACOFLO-HXUWFJFHSA-N |
| XLogP | 4.50 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.00 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |