C17H25ClN2O — CID 100836996
(1S)-1-(2-chlorophenyl)-2-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]ethanol (PubChem CID 100836996) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is (1S)-1-(2-chlorophenyl)-2-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]ethanol.
| Compound Name | (1S)-1-(2-chlorophenyl)-2-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 100836996 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (1S)-1-(2-chlorophenyl)-2-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]ethanol |
| SMILES | O[C@H](CN1CCC[C@@H](N2CCCC2)C1)c1ccccc1Cl |
| InChI | InChI=1S/C17H25ClN2O/c18-16-8-2-1-7-15(16)17(21)13-19-9-5-6-14(12-19)20-10-3-4-11-20/h1-2,7-8,14,17,21H,3-6,9-13H2/t14-,17-/m1/s1 |
| InChIKey | ARXRLDAKICEJLT-RHSMWYFYSA-N |
| XLogP | 2.93 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |