C18H27ClN2O — CID 111488895
1-(2-chlorophenyl)-2-[3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]ethanol (PubChem CID 111488895) has the molecular formula C18H27ClN2O and a molecular weight of 322.88 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-[3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]ethanol.
| Compound Name | 1-(2-chlorophenyl)-2-[3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]ethanol |
|---|---|
| PubChem CID | 111488895 |
| Molecular Formula | C18H27ClN2O |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-(2-chlorophenyl)-2-[3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]ethanol |
| SMILES | OC(CN1CCC(CN2CCCCC2)C1)c1ccccc1Cl |
| InChI | InChI=1S/C18H27ClN2O/c19-17-7-3-2-6-16(17)18(22)14-21-11-8-15(13-21)12-20-9-4-1-5-10-20/h2-3,6-7,15,18,22H,1,4-5,8-14H2 |
| InChIKey | WMZBCKMKMTXSJD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |