C17H24ClNO3 — CID 110891469
ethyl 2-[1-[2-(2-chlorophenyl)-2-hydroxyethyl]piperidin-4-yl]acetate (PubChem CID 110891469) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is ethyl 2-[1-[2-(2-chlorophenyl)-2-hydroxyethyl]piperidin-4-yl]acetate.
| Compound Name | ethyl 2-[1-[2-(2-chlorophenyl)-2-hydroxyethyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 110891469 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | ethyl 2-[1-[2-(2-chlorophenyl)-2-hydroxyethyl]piperidin-4-yl]acetate |
| SMILES | CCOC(=O)CC1CCN(CC(O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H24ClNO3/c1-2-22-17(21)11-13-7-9-19(10-8-13)12-16(20)14-5-3-4-6-15(14)18/h3-6,13,16,20H,2,7-12H2,1H3 |
| InChIKey | BJPDFPRKFMCOBQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |