C18H24ClN3O — CID 95978859
(1R)-1-(2-chlorophenyl)-2-[4-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]ethanol (PubChem CID 95978859) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is (1R)-1-(2-chlorophenyl)-2-[4-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]ethanol.
| Compound Name | (1R)-1-(2-chlorophenyl)-2-[4-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 95978859 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (1R)-1-(2-chlorophenyl)-2-[4-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]ethanol |
| SMILES | Cc1cnn(CC2CCN(C[C@H](O)c3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C18H24ClN3O/c1-14-10-20-22(11-14)12-15-6-8-21(9-7-15)13-18(23)16-4-2-3-5-17(16)19/h2-5,10-11,15,18,23H,6-9,12-13H2,1H3/t18-/m0/s1 |
| InChIKey | AJGHNCYMXSMRGE-SFHVURJKSA-N |
| XLogP | 3.29 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |