C17H20F3N3 — CID 166314468
4-[(4-methylpyrazol-1-yl)methyl]-1-[(2,3,6-trifluorophenyl)methyl]piperidine (PubChem CID 166314468) has the molecular formula C17H20F3N3 and a molecular weight of 323.36 g/mol. Its IUPAC name is 4-[(4-methylpyrazol-1-yl)methyl]-1-[(2,3,6-trifluorophenyl)methyl]piperidine.
| Compound Name | 4-[(4-methylpyrazol-1-yl)methyl]-1-[(2,3,6-trifluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 166314468 |
| Molecular Formula | C17H20F3N3 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 4-[(4-methylpyrazol-1-yl)methyl]-1-[(2,3,6-trifluorophenyl)methyl]piperidine |
| SMILES | Cc1cnn(CC2CCN(Cc3c(F)ccc(F)c3F)CC2)c1 |
| InChI | InChI=1S/C17H20F3N3/c1-12-8-21-23(9-12)10-13-4-6-22(7-5-13)11-14-15(18)2-3-16(19)17(14)20/h2-3,8-9,13H,4-7,10-11H2,1H3 |
| InChIKey | BYMDUVPPFKMYLT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|