C24H33N3 — CID 51636134
1-phenyl-4-[(3R)-1-(3-phenylpropyl)piperidin-3-yl]piperazine (PubChem CID 51636134) has the molecular formula C24H33N3 and a molecular weight of 363.55 g/mol. Its IUPAC name is 1-phenyl-4-[(3R)-1-(3-phenylpropyl)piperidin-3-yl]piperazine.
| Compound Name | 1-phenyl-4-[(3R)-1-(3-phenylpropyl)piperidin-3-yl]piperazine |
|---|---|
| PubChem CID | 51636134 |
| Molecular Formula | C24H33N3 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.27 |
| IUPAC Name | 1-phenyl-4-[(3R)-1-(3-phenylpropyl)piperidin-3-yl]piperazine |
| SMILES | c1ccc(CCCN2CCC[C@@H](N3CCN(c4ccccc4)CC3)C2)cc1 |
| InChI | InChI=1S/C24H33N3/c1-3-9-22(10-4-1)11-7-15-25-16-8-14-24(21-25)27-19-17-26(18-20-27)23-12-5-2-6-13-23/h1-6,9-10,12-13,24H,7-8,11,14-21H2/t24-/m1/s1 |
| InChIKey | XQZRTEJEVOZIHQ-XMMPIXPASA-N |
| XLogP | 3.91 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |