C13H15N2O2- — CID 22172549
2-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole-3-carboxylate (PubChem CID 22172549) has the molecular formula C13H15N2O2- and a molecular weight of 231.27 g/mol. Its IUPAC name is 2-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole-3-carboxylate.
| Compound Name | 2-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole-3-carboxylate |
|---|---|
| PubChem CID | 22172549 |
| Molecular Formula | C13H15N2O2- |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole-3-carboxylate |
| SMILES | O=C([O-])C1N(c2ccccc2)CC2CCCN21 |
| InChI | InChI=1S/C13H16N2O2/c16-13(17)12-14-8-4-7-11(14)9-15(12)10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2,(H,16,17)/p-1 |
| InChIKey | QXZJFGDIMULWHP-UHFFFAOYSA-M |
| XLogP | 0.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |