C11H12NO4S- — CID 91386737
[(2S)-1-phenylpyrrolidine-2-carbonyl] sulfite (PubChem CID 91386737) has the molecular formula C11H12NO4S- and a molecular weight of 254.29 g/mol. Its IUPAC name is [(2S)-1-phenylpyrrolidine-2-carbonyl] sulfite.
| Compound Name | [(2S)-1-phenylpyrrolidine-2-carbonyl] sulfite |
|---|---|
| PubChem CID | 91386737 |
| Molecular Formula | C11H12NO4S- |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | [(2S)-1-phenylpyrrolidine-2-carbonyl] sulfite |
| SMILES | O=C(OS(=O)[O-])[C@@H]1CCCN1c1ccccc1 |
| InChI | InChI=1S/C11H13NO4S/c13-11(16-17(14)15)10-7-4-8-12(10)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H,14,15)/p-1/t10-/m0/s1 |
| InChIKey | SMNSTHYHKJWARI-JTQLQIEISA-M |
| XLogP | 0.99 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|