C12H16N4O — CID 54358653
N-(diaminomethylidene)-1-phenylpyrrolidine-2-carboxamide (PubChem CID 54358653) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is N-(diaminomethylidene)-1-phenylpyrrolidine-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-1-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 54358653 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | N-(diaminomethylidene)-1-phenylpyrrolidine-2-carboxamide |
| SMILES | NC(N)=NC(=O)C1CCCN1c1ccccc1 |
| InChI | InChI=1S/C12H16N4O/c13-12(14)15-11(17)10-7-4-8-16(10)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H4,13,14,15,17) |
| InChIKey | UKXMBZNLRMZAKJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|