C12H15N5O3 — CID 146030168
N-(diaminomethylidene)-1-(3-nitrophenyl)pyrrolidine-2-carboxamide (PubChem CID 146030168) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(diaminomethylidene)-1-(3-nitrophenyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-1-(3-nitrophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146030168 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(diaminomethylidene)-1-(3-nitrophenyl)pyrrolidine-2-carboxamide |
| SMILES | NC(N)=NC(=O)C1CCCN1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15N5O3/c13-12(14)15-11(18)10-5-2-6-16(10)8-3-1-4-9(7-8)17(19)20/h1,3-4,7,10H,2,5-6H2,(H4,13,14,15,18) |
| InChIKey | TUBPCMLNYQUPCU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|