C24H34N4O4 — CID 158767207
2-(methoxymethyl)-1-(3-nitrophenyl)pyrrolidine;3-[2-(methoxymethyl)pyrrolidin-1-yl]aniline (PubChem CID 158767207) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-(methoxymethyl)-1-(3-nitrophenyl)pyrrolidine;3-[2-(methoxymethyl)pyrrolidin-1-yl]aniline.
| Compound Name | 2-(methoxymethyl)-1-(3-nitrophenyl)pyrrolidine;3-[2-(methoxymethyl)pyrrolidin-1-yl]aniline |
|---|---|
| PubChem CID | 158767207 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-(methoxymethyl)-1-(3-nitrophenyl)pyrrolidine;3-[2-(methoxymethyl)pyrrolidin-1-yl]aniline |
| SMILES | COCC1CCCN1c1cccc(N)c1.COCC1CCCN1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N2O3.C12H18N2O/c1-17-9-12-6-3-7-13(12)10-4-2-5-11(8-10)14(15)16;1-15-9-12-6-3-7-14(12)11-5-2-4-10(13)8-11/h2,4-5,8,12H,3,6-7,9H2,1H3;2,4-5,8,12H,3,6-7,9,13H2,1H3 |
| InChIKey | IPKGWRRZAAMBMV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|