C17H24N2O2 — CID 13025491
butyl 2-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole-3-carboxylate (PubChem CID 13025491) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is butyl 2-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole-3-carboxylate.
| Compound Name | butyl 2-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole-3-carboxylate |
|---|---|
| PubChem CID | 13025491 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | butyl 2-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole-3-carboxylate |
| SMILES | CCCCOC(=O)C1N(c2ccccc2)CC2CCCN21 |
| InChI | InChI=1S/C17H24N2O2/c1-2-3-12-21-17(20)16-18-11-7-10-15(18)13-19(16)14-8-5-4-6-9-14/h4-6,8-9,15-16H,2-3,7,10-13H2,1H3 |
| InChIKey | PQEJCQNPUSBWLF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|