C16H21NOS — CID 11448762
(4S,9aS)-4-benzyl-4-methyl-1,2,7,8,9,9a-hexahydropyrrolo[1,2-d][1,4]thiazepin-5-one (PubChem CID 11448762) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is (4S,9aS)-4-benzyl-4-methyl-1,2,7,8,9,9a-hexahydropyrrolo[1,2-d][1,4]thiazepin-5-one.
| Compound Name | (4S,9aS)-4-benzyl-4-methyl-1,2,7,8,9,9a-hexahydropyrrolo[1,2-d][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 11448762 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (4S,9aS)-4-benzyl-4-methyl-1,2,7,8,9,9a-hexahydropyrrolo[1,2-d][1,4]thiazepin-5-one |
| SMILES | C[C@@]1(Cc2ccccc2)SCC[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C16H21NOS/c1-16(12-13-6-3-2-4-7-13)15(18)17-10-5-8-14(17)9-11-19-16/h2-4,6-7,14H,5,8-12H2,1H3/t14-,16-/m0/s1 |
| InChIKey | DAWZEEMGCXIZOP-HOCLYGCPSA-N |
| XLogP | 3.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |