C13H23NOS — CID 11218706
(4R,10aS)-4-methyl-4-propyl-2,7,8,9,10,10a-hexahydro-1H-pyrido[1,2-d][1,4]thiazepin-5-one (PubChem CID 11218706) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is (4R,10aS)-4-methyl-4-propyl-2,7,8,9,10,10a-hexahydro-1H-pyrido[1,2-d][1,4]thiazepin-5-one.
| Compound Name | (4R,10aS)-4-methyl-4-propyl-2,7,8,9,10,10a-hexahydro-1H-pyrido[1,2-d][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 11218706 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (4R,10aS)-4-methyl-4-propyl-2,7,8,9,10,10a-hexahydro-1H-pyrido[1,2-d][1,4]thiazepin-5-one |
| SMILES | CCC[C@@]1(C)SCC[C@@H]2CCCCN2C1=O |
| InChI | InChI=1S/C13H23NOS/c1-3-8-13(2)12(15)14-9-5-4-6-11(14)7-10-16-13/h11H,3-10H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | JGEYZIKNCIXALN-WCQYABFASA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |