C18H21N2O2P — CID 15522120
(1R,3aS)-1-(2-methylphenoxy)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole 1-oxide (PubChem CID 15522120) has the molecular formula C18H21N2O2P and a molecular weight of 328.35 g/mol. Its IUPAC name is (1R,3aS)-1-(2-methylphenoxy)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole 1-oxide.
| Compound Name | (1R,3aS)-1-(2-methylphenoxy)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole 1-oxide |
|---|---|
| PubChem CID | 15522120 |
| Molecular Formula | C18H21N2O2P |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (1R,3aS)-1-(2-methylphenoxy)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole 1-oxide |
| SMILES | Cc1ccccc1O[P@@]1(=O)N(c2ccccc2)C[C@@H]2CCCN21 |
| InChI | InChI=1S/C18H21N2O2P/c1-15-8-5-6-12-18(15)22-23(21)19-13-7-11-17(19)14-20(23)16-9-3-2-4-10-16/h2-6,8-10,12,17H,7,11,13-14H2,1H3/t17-,23+/m0/s1 |
| InChIKey | OMKSDAUYBCUBLF-GAJHUEQPSA-N |
| XLogP | 4.47 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|