C56H56N4O8P4 — CID 140957011
2,2,4,4,6,6,8,8-octakis(2-methylphenoxy)-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene (PubChem CID 140957011) has the molecular formula C56H56N4O8P4 and a molecular weight of 1036.98 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8-octakis(2-methylphenoxy)-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene.
| Compound Name | 2,2,4,4,6,6,8,8-octakis(2-methylphenoxy)-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 140957011 |
| Molecular Formula | C56H56N4O8P4 |
| Molecular Weight | 1036.98 g/mol |
| Exact Mass | 1036.30 |
| IUPAC Name | 2,2,4,4,6,6,8,8-octakis(2-methylphenoxy)-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene |
| SMILES | Cc1ccccc1OP1(Oc2ccccc2C)=NP(Oc2ccccc2C)(Oc2ccccc2C)=NP(Oc2ccccc2C)(Oc2ccccc2C)=NP(Oc2ccccc2C)(Oc2ccccc2C)=N1 |
| InChI | InChI=1S/C56H56N4O8P4/c1-41-25-9-17-33-49(41)61-69(62-50-34-18-10-26-42(50)2)57-70(63-51-35-19-11-27-43(51)3,64-52-36-20-12-28-44(52)4)59-72(67-55-39-23-15-31-47(55)7,68-56-40-24-16-32-48(56)8)60-71(58-69,65-53-37-21-13-29-45(53)5)66-54-38-22-14-30-46(54)6/h9-40H,1-8H3 |
| InChIKey | QSVJAMBCIFARIJ-UHFFFAOYSA-N |
| XLogP | 18.88 |
| TPSA | 123.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.98 |
| LogP ≤ 5 | 18.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|