C17H18ClN2O2P — CID 100964717
2-[(3aS)-1-oxido-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-ium-1-yl]-3-chlorophenol (PubChem CID 100964717) has the molecular formula C17H18ClN2O2P and a molecular weight of 348.77 g/mol. Its IUPAC name is 2-[(3aS)-1-oxido-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-ium-1-yl]-3-chlorophenol.
| Compound Name | 2-[(3aS)-1-oxido-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-ium-1-yl]-3-chlorophenol |
|---|---|
| PubChem CID | 100964717 |
| Molecular Formula | C17H18ClN2O2P |
| Molecular Weight | 348.77 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-[(3aS)-1-oxido-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-ium-1-yl]-3-chlorophenol |
| SMILES | [O-][P+]1(c2c(O)cccc2Cl)N(c2ccccc2)C[C@@H]2CCCN21 |
| InChI | InChI=1S/C17H18ClN2O2P/c18-15-9-4-10-16(21)17(15)23(22)19-11-5-8-14(19)12-20(23)13-6-2-1-3-7-13/h1-4,6-7,9-10,14,21H,5,8,11-12H2/t14-,23?/m0/s1 |
| InChIKey | TXOUWYUYOITXAO-JRQMZCAUSA-N |
| XLogP | 2.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|