C10H10O8S2 — CID 139603556
2,7-dihydroxy-1H-naphthalene-1,2-disulfonic acid (PubChem CID 139603556) has the molecular formula C10H10O8S2 and a molecular weight of 322.32 g/mol. Its IUPAC name is 2,7-dihydroxy-1H-naphthalene-1,2-disulfonic acid.
| Compound Name | 2,7-dihydroxy-1H-naphthalene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 139603556 |
| Molecular Formula | C10H10O8S2 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 2,7-dihydroxy-1H-naphthalene-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)C1c2cc(O)ccc2C=CC1(O)S(=O)(=O)O |
| InChI | InChI=1S/C10H10O8S2/c11-7-2-1-6-3-4-10(12,20(16,17)18)9(8(6)5-7)19(13,14)15/h1-5,9,11-12H,(H,13,14,15)(H,16,17,18) |
| InChIKey | DXOLUNNQMVAIAZ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|