About dimethyl 1,2-dihydroxycyclohexa-3,5-diene-1,3-dicarboxylate
dimethyl 1,2-dihydroxycyclohexa-3,5-diene-1,3-dicarboxylate (PubChem CID 67068970) has the molecular formula C10H12O6
and a molecular weight of 228.20 g/mol. Its IUPAC name is dimethyl 1,2-dihydroxycyclohexa-3,5-diene-1,3-dicarboxylate.
Analyze dimethyl 1,2-dihydroxycyclohexa-3,5-diene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1,2-dihydroxycyclohexa-3,5-diene-1,3-dicarboxylate?
The IUPAC name of dimethyl 1,2-dihydroxycyclohexa-3,5-diene-1,3-dicarboxylate (CID 67068970) is dimethyl 1,2-dihydroxycyclohexa-3,5-diene-1,3-dicarboxylate.
What is the SMILES notation for dimethyl 1,2-dihydroxycyclohexa-3,5-diene-1,3-dicarboxylate?
The canonical SMILES for dimethyl 1,2-dihydroxycyclohexa-3,5-diene-1,3-dicarboxylate is COC(=O)C1=CC=CC(O)(C(=O)OC)C1O.
What is the InChIKey of dimethyl 1,2-dihydroxycyclohexa-3,5-diene-1,3-dicarboxylate?
The InChIKey is HZEQWZPNZIEMRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O6/c1-15-8(12)6-4-3-5-10(14,7(6)11)9(13)16-2/h3-5,7,11,14H,1-2H3.
What are the key properties of dimethyl 1,2-dihydroxycyclohexa-3,5-diene-1,3-dicarboxylate?
dimethyl 1,2-dihydroxycyclohexa-3,5-diene-1,3-dicarboxylate has a molecular weight of 228.20 g/mol, XLogP of -1.08, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1,2-dihydroxycyclohexa-3,5-diene-1,3-dicarboxylate is sourced from PubChem (CID 67068970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).