C16H12O10 — CID 10737472
dimethyl (1S,2R,6R,7S)-6,7-dihydroxy-5,8,11,12-tetraoxotricyclo[5.3.1.12,6]dodeca-3,9-diene-3,10-dicarboxylate (PubChem CID 10737472) has the molecular formula C16H12O10 and a molecular weight of 364.26 g/mol. Its IUPAC name is dimethyl (1S,2R,6R,7S)-6,7-dihydroxy-5,8,11,12-tetraoxotricyclo[5.3.1.12,6]dodeca-3,9-diene-3,10-dicarboxylate.
| Compound Name | dimethyl (1S,2R,6R,7S)-6,7-dihydroxy-5,8,11,12-tetraoxotricyclo[5.3.1.12,6]dodeca-3,9-diene-3,10-dicarboxylate |
|---|---|
| PubChem CID | 10737472 |
| Molecular Formula | C16H12O10 |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | dimethyl (1S,2R,6R,7S)-6,7-dihydroxy-5,8,11,12-tetraoxotricyclo[5.3.1.12,6]dodeca-3,9-diene-3,10-dicarboxylate |
| SMILES | COC(=O)C1=CC(=O)[C@]2(O)C(=O)[C@H]1[C@H]1C(=O)[C@]2(O)C(=O)C=C1C(=O)OC |
| InChI | InChI=1S/C16H12O10/c1-25-13(21)5-3-7(17)15(23)11(19)9(5)10-6(14(22)26-2)4-8(18)16(15,24)12(10)20/h3-4,9-10,23-24H,1-2H3/t9-,10+,15+,16- |
| InChIKey | DKJMZBBALOLTBK-RPCZKNTGSA-N |
| XLogP | -2.80 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|