C18H22O8 — CID 101401913
methyl (1S,2S,7R,8R)-6,6,12,12-tetramethoxy-5,11-dioxotricyclo[6.2.2.02,7]dodeca-3,9-diene-3-carboxylate (PubChem CID 101401913) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is methyl (1S,2S,7R,8R)-6,6,12,12-tetramethoxy-5,11-dioxotricyclo[6.2.2.02,7]dodeca-3,9-diene-3-carboxylate.
| Compound Name | methyl (1S,2S,7R,8R)-6,6,12,12-tetramethoxy-5,11-dioxotricyclo[6.2.2.02,7]dodeca-3,9-diene-3-carboxylate |
|---|---|
| PubChem CID | 101401913 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | methyl (1S,2S,7R,8R)-6,6,12,12-tetramethoxy-5,11-dioxotricyclo[6.2.2.02,7]dodeca-3,9-diene-3-carboxylate |
| SMILES | COC(=O)C1=CC(=O)C(OC)(OC)[C@@H]2[C@@H]1[C@@H]1C=C[C@H]2C(OC)(OC)C1=O |
| InChI | InChI=1S/C18H22O8/c1-22-16(21)10-8-12(19)18(25-4,26-5)14-11-7-6-9(13(10)14)15(20)17(11,23-2)24-3/h6-9,11,13-14H,1-5H3/t9-,11+,13+,14-/m0/s1 |
| InChIKey | LVSIPULTABJNSQ-FRJFDASCSA-N |
| XLogP | 0.26 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|