C12H16O4 — CID 101086298
(1R,2R,6R,7R)-8,8-dimethoxy-3-oxatricyclo[5.2.2.02,6]undec-10-en-9-one (PubChem CID 101086298) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (1R,2R,6R,7R)-8,8-dimethoxy-3-oxatricyclo[5.2.2.02,6]undec-10-en-9-one.
| Compound Name | (1R,2R,6R,7R)-8,8-dimethoxy-3-oxatricyclo[5.2.2.02,6]undec-10-en-9-one |
|---|---|
| PubChem CID | 101086298 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (1R,2R,6R,7R)-8,8-dimethoxy-3-oxatricyclo[5.2.2.02,6]undec-10-en-9-one |
| SMILES | COC1(OC)C(=O)[C@@H]2C=C[C@@H]1[C@H]1CCO[C@H]12 |
| InChI | InChI=1S/C12H16O4/c1-14-12(15-2)9-4-3-8(11(12)13)10-7(9)5-6-16-10/h3-4,7-10H,5-6H2,1-2H3/t7-,8-,9-,10-/m1/s1 |
| InChIKey | XQQIPVPYLOGGNL-ZYUZMQFOSA-N |
| XLogP | 0.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|