C16H16O3 — CID 101210349
(1R,3R,6R,7R,10R)-3-methoxy-10-phenyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one (PubChem CID 101210349) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is (1R,3R,6R,7R,10R)-3-methoxy-10-phenyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one.
| Compound Name | (1R,3R,6R,7R,10R)-3-methoxy-10-phenyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
|---|---|
| PubChem CID | 101210349 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (1R,3R,6R,7R,10R)-3-methoxy-10-phenyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
| SMILES | CO[C@@]12OC[C@@H]3[C@@H](c4ccccc4)[C@@H](C=C[C@H]31)C2=O |
| InChI | InChI=1S/C16H16O3/c1-18-16-13-8-7-11(15(16)17)14(12(13)9-19-16)10-5-3-2-4-6-10/h2-8,11-14H,9H2,1H3/t11-,12+,13-,14+,16-/m1/s1 |
| InChIKey | HGGSVWDKJCLIAF-YMSVYLFOSA-N |
| XLogP | 2.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|