C28H32O8 — CID 10625076
(1S,5R,6S,7R,8S,12S,14S,15S)-14,15-dimethoxy-14,15-dimethyl-6,7-diphenyl-3,10,13,16-tetraoxatricyclo[10.4.0.05,8]hexadecane-4,9-dione (PubChem CID 10625076) has the molecular formula C28H32O8 and a molecular weight of 496.56 g/mol. Its IUPAC name is (1S,5R,6S,7R,8S,12S,14S,15S)-14,15-dimethoxy-14,15-dimethyl-6,7-diphenyl-3,10,13,16-tetraoxatricyclo[10.4.0.05,8]hexadecane-4,9-dione.
| Compound Name | (1S,5R,6S,7R,8S,12S,14S,15S)-14,15-dimethoxy-14,15-dimethyl-6,7-diphenyl-3,10,13,16-tetraoxatricyclo[10.4.0.05,8]hexadecane-4,9-dione |
|---|---|
| PubChem CID | 10625076 |
| Molecular Formula | C28H32O8 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (1S,5R,6S,7R,8S,12S,14S,15S)-14,15-dimethoxy-14,15-dimethyl-6,7-diphenyl-3,10,13,16-tetraoxatricyclo[10.4.0.05,8]hexadecane-4,9-dione |
| SMILES | CO[C@@]1(C)O[C@H]2COC(=O)[C@@H]3[C@H](C(=O)OC[C@@H]2O[C@]1(C)OC)[C@@H](c1ccccc1)[C@H]3c1ccccc1 |
| InChI | InChI=1S/C28H32O8/c1-27(31-3)28(2,32-4)36-20-16-34-26(30)24-22(18-13-9-6-10-14-18)21(17-11-7-5-8-12-17)23(24)25(29)33-15-19(20)35-27/h5-14,19-24H,15-16H2,1-4H3/t19-,20-,21-,22+,23+,24-,27-,28-/m0/s1 |
| InChIKey | KSOAHARYUABOMW-BWTIJCIISA-N |
| XLogP | 3.41 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |