C20H26O8 — CID 11661174
(3S,5R,6R)-3-[(3R,4R)-3-[(S)-hydroxy(phenyl)methyl]-2-oxooxan-4-yl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one (PubChem CID 11661174) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is (3S,5R,6R)-3-[(3R,4R)-3-[(S)-hydroxy(phenyl)methyl]-2-oxooxan-4-yl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one.
| Compound Name | (3S,5R,6R)-3-[(3R,4R)-3-[(S)-hydroxy(phenyl)methyl]-2-oxooxan-4-yl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 11661174 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (3S,5R,6R)-3-[(3R,4R)-3-[(S)-hydroxy(phenyl)methyl]-2-oxooxan-4-yl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
| SMILES | CO[C@]1(C)OC(=O)[C@H]([C@@H]2CCOC(=O)[C@H]2[C@H](O)c2ccccc2)O[C@@]1(C)OC |
| InChI | InChI=1S/C20H26O8/c1-19(24-3)20(2,25-4)28-18(23)16(27-19)13-10-11-26-17(22)14(13)15(21)12-8-6-5-7-9-12/h5-9,13-16,21H,10-11H2,1-4H3/t13-,14-,15-,16+,19-,20-/m1/s1 |
| InChIKey | PZPRLMMJXIYTMT-OQTPBVATSA-N |
| XLogP | 1.57 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |