C21H28O9 — CID 11654755
(3S,5R,6R)-3-[(3R,4R)-3-[(R)-hydroxy-(4-methoxyphenyl)methyl]-2-oxooxan-4-yl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one (PubChem CID 11654755) has the molecular formula C21H28O9 and a molecular weight of 424.45 g/mol. Its IUPAC name is (3S,5R,6R)-3-[(3R,4R)-3-[(R)-hydroxy-(4-methoxyphenyl)methyl]-2-oxooxan-4-yl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one.
| Compound Name | (3S,5R,6R)-3-[(3R,4R)-3-[(R)-hydroxy-(4-methoxyphenyl)methyl]-2-oxooxan-4-yl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 11654755 |
| Molecular Formula | C21H28O9 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (3S,5R,6R)-3-[(3R,4R)-3-[(R)-hydroxy-(4-methoxyphenyl)methyl]-2-oxooxan-4-yl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
| SMILES | COc1ccc([C@H](O)[C@@H]2C(=O)OCC[C@H]2[C@@H]2O[C@@](C)(OC)[C@](C)(OC)OC2=O)cc1 |
| InChI | InChI=1S/C21H28O9/c1-20(26-4)21(2,27-5)30-19(24)17(29-20)14-10-11-28-18(23)15(14)16(22)12-6-8-13(25-3)9-7-12/h6-9,14-17,22H,10-11H2,1-5H3/t14-,15-,16+,17+,20-,21-/m1/s1 |
| InChIKey | LITPFZFLDUFCCB-DNUSTOCVSA-N |
| XLogP | 1.58 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |