C17H20O7 — CID 101159608
(4R)-4-[(2R,5S,6S)-5,6-dimethoxy-5,6-dimethyl-3-oxo-1,4-dioxan-2-yl]-3,4-dihydrochromen-2-one (PubChem CID 101159608) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is (4R)-4-[(2R,5S,6S)-5,6-dimethoxy-5,6-dimethyl-3-oxo-1,4-dioxan-2-yl]-3,4-dihydrochromen-2-one.
| Compound Name | (4R)-4-[(2R,5S,6S)-5,6-dimethoxy-5,6-dimethyl-3-oxo-1,4-dioxan-2-yl]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 101159608 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (4R)-4-[(2R,5S,6S)-5,6-dimethoxy-5,6-dimethyl-3-oxo-1,4-dioxan-2-yl]-3,4-dihydrochromen-2-one |
| SMILES | CO[C@@]1(C)OC(=O)[C@@H]([C@@H]2CC(=O)Oc3ccccc32)O[C@]1(C)OC |
| InChI | InChI=1S/C17H20O7/c1-16(20-3)17(2,21-4)24-15(19)14(23-16)11-9-13(18)22-12-8-6-5-7-10(11)12/h5-8,11,14H,9H2,1-4H3/t11-,14-,16+,17+/m1/s1 |
| InChIKey | MEERPWNFPVGWGV-OFIKQIQMSA-N |
| XLogP | 1.75 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|