C13H17O5P — CID 11150288
4-diethoxyphosphoryl-3,4-dihydrochromen-2-one (PubChem CID 11150288) has the molecular formula C13H17O5P and a molecular weight of 284.25 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-3,4-dihydrochromen-2-one.
| Compound Name | 4-diethoxyphosphoryl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 11150288 |
| Molecular Formula | C13H17O5P |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-diethoxyphosphoryl-3,4-dihydrochromen-2-one |
| SMILES | CCOP(=O)(OCC)C1CC(=O)Oc2ccccc21 |
| InChI | InChI=1S/C13H17O5P/c1-3-16-19(15,17-4-2)12-9-13(14)18-11-8-6-5-7-10(11)12/h5-8,12H,3-4,9H2,1-2H3 |
| InChIKey | XZZQYRAOBVOPIY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|