C16H22NO5P — CID 102434849
(3aR,9bS)-3a-diethoxyphosphoryl-2-methyl-3,9b-dihydro-1H-chromeno[3,4-c]pyrrol-4-one (PubChem CID 102434849) has the molecular formula C16H22NO5P and a molecular weight of 339.33 g/mol. Its IUPAC name is (3aR,9bS)-3a-diethoxyphosphoryl-2-methyl-3,9b-dihydro-1H-chromeno[3,4-c]pyrrol-4-one.
| Compound Name | (3aR,9bS)-3a-diethoxyphosphoryl-2-methyl-3,9b-dihydro-1H-chromeno[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 102434849 |
| Molecular Formula | C16H22NO5P |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (3aR,9bS)-3a-diethoxyphosphoryl-2-methyl-3,9b-dihydro-1H-chromeno[3,4-c]pyrrol-4-one |
| SMILES | CCOP(=O)(OCC)[C@@]12CN(C)C[C@@H]1c1ccccc1OC2=O |
| InChI | InChI=1S/C16H22NO5P/c1-4-20-23(19,21-5-2)16-11-17(3)10-13(16)12-8-6-7-9-14(12)22-15(16)18/h6-9,13H,4-5,10-11H2,1-3H3/t13-,16+/m1/s1 |
| InChIKey | CCYFIBRKSKXOPB-CJNGLKHVSA-N |
| XLogP | 2.64 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|