C19H18NO5P — CID 139190904
(10bR)-10b-diethoxyphosphorylisoindolo[2,1-a]indole-6,11-dione (PubChem CID 139190904) has the molecular formula C19H18NO5P and a molecular weight of 371.33 g/mol. Its IUPAC name is (10bR)-10b-diethoxyphosphorylisoindolo[2,1-a]indole-6,11-dione.
| Compound Name | (10bR)-10b-diethoxyphosphorylisoindolo[2,1-a]indole-6,11-dione |
|---|---|
| PubChem CID | 139190904 |
| Molecular Formula | C19H18NO5P |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (10bR)-10b-diethoxyphosphorylisoindolo[2,1-a]indole-6,11-dione |
| SMILES | CCOP(=O)(OCC)[C@]12C(=O)c3ccccc3N1C(=O)c1ccccc12 |
| InChI | InChI=1S/C19H18NO5P/c1-3-24-26(23,25-4-2)19-15-11-7-5-9-13(15)18(22)20(19)16-12-8-6-10-14(16)17(19)21/h5-12H,3-4H2,1-2H3/t19-/m1/s1 |
| InChIKey | FSZZDKBGIBJNQX-LJQANCHMSA-N |
| XLogP | 3.96 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|