C26H22N2O2 — CID 134954136
(10bR,11S)-6-oxo-10b-(3-phenylmethoxypropyl)-11H-isoindolo[2,1-a]indole-11-carbonitrile (PubChem CID 134954136) has the molecular formula C26H22N2O2 and a molecular weight of 394.47 g/mol. Its IUPAC name is (10bR,11S)-6-oxo-10b-(3-phenylmethoxypropyl)-11H-isoindolo[2,1-a]indole-11-carbonitrile.
| Compound Name | (10bR,11S)-6-oxo-10b-(3-phenylmethoxypropyl)-11H-isoindolo[2,1-a]indole-11-carbonitrile |
|---|---|
| PubChem CID | 134954136 |
| Molecular Formula | C26H22N2O2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (10bR,11S)-6-oxo-10b-(3-phenylmethoxypropyl)-11H-isoindolo[2,1-a]indole-11-carbonitrile |
| SMILES | N#C[C@H]1c2ccccc2N2C(=O)c3ccccc3[C@@]12CCCOCc1ccccc1 |
| InChI | InChI=1S/C26H22N2O2/c27-17-23-20-11-5-7-14-24(20)28-25(29)21-12-4-6-13-22(21)26(23,28)15-8-16-30-18-19-9-2-1-3-10-19/h1-7,9-14,23H,8,15-16,18H2/t23-,26-/m0/s1 |
| InChIKey | URYPGVYGQCGFKQ-OZXSUGGESA-N |
| XLogP | 5.16 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|