C27H19N3O3 — CID 134954141
(10bR,11S)-10b-[3-(1,3-dioxoisoindol-2-yl)propyl]-6-oxo-11H-isoindolo[2,1-a]indole-11-carbonitrile (PubChem CID 134954141) has the molecular formula C27H19N3O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is (10bR,11S)-10b-[3-(1,3-dioxoisoindol-2-yl)propyl]-6-oxo-11H-isoindolo[2,1-a]indole-11-carbonitrile.
| Compound Name | (10bR,11S)-10b-[3-(1,3-dioxoisoindol-2-yl)propyl]-6-oxo-11H-isoindolo[2,1-a]indole-11-carbonitrile |
|---|---|
| PubChem CID | 134954141 |
| Molecular Formula | C27H19N3O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | (10bR,11S)-10b-[3-(1,3-dioxoisoindol-2-yl)propyl]-6-oxo-11H-isoindolo[2,1-a]indole-11-carbonitrile |
| SMILES | N#C[C@H]1c2ccccc2N2C(=O)c3ccccc3[C@@]12CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H19N3O3/c28-16-22-19-10-4-6-13-23(19)30-26(33)20-11-3-5-12-21(20)27(22,30)14-7-15-29-24(31)17-8-1-2-9-18(17)25(29)32/h1-6,8-13,22H,7,14-15H2/t22-,27-/m0/s1 |
| InChIKey | SIHLNVFNOUURFD-CUNXSJBXSA-N |
| XLogP | 4.24 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|