C18H13FN2O3 — CID 11012759
2-[2-(3-fluoro-2-oxo-1H-indol-3-yl)ethyl]isoindole-1,3-dione (PubChem CID 11012759) has the molecular formula C18H13FN2O3 and a molecular weight of 324.31 g/mol. Its IUPAC name is 2-[2-(3-fluoro-2-oxo-1H-indol-3-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3-fluoro-2-oxo-1H-indol-3-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11012759 |
| Molecular Formula | C18H13FN2O3 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-[2-(3-fluoro-2-oxo-1H-indol-3-yl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCC1(F)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C18H13FN2O3/c19-18(13-7-3-4-8-14(13)20-17(18)24)9-10-21-15(22)11-5-1-2-6-12(11)16(21)23/h1-8H,9-10H2,(H,20,24) |
| InChIKey | BUYZZKASVUBKQF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|