C22H18N2O5 — CID 135305783
(6'S)-6'-[2-(1,3-dioxoisoindol-2-yl)ethyl]spiro[1H-indole-3,2'-oxane]-2,4'-dione (PubChem CID 135305783) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is (6'S)-6'-[2-(1,3-dioxoisoindol-2-yl)ethyl]spiro[1H-indole-3,2'-oxane]-2,4'-dione.
| Compound Name | (6'S)-6'-[2-(1,3-dioxoisoindol-2-yl)ethyl]spiro[1H-indole-3,2'-oxane]-2,4'-dione |
|---|---|
| PubChem CID | 135305783 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (6'S)-6'-[2-(1,3-dioxoisoindol-2-yl)ethyl]spiro[1H-indole-3,2'-oxane]-2,4'-dione |
| SMILES | O=C1C[C@H](CCN2C(=O)c3ccccc3C2=O)OC2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C22H18N2O5/c25-13-11-14(9-10-24-19(26)15-5-1-2-6-16(15)20(24)27)29-22(12-13)17-7-3-4-8-18(17)23-21(22)28/h1-8,14H,9-12H2,(H,23,28)/t14-,22?/m0/s1 |
| InChIKey | UDZLLFXWWCVQGI-XLEXHMCLSA-N |
| XLogP | 2.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|