C18H23NO3 — CID 118340195
(4'R,6'S)-4'-hydroxy-4'-prop-2-enyl-6'-propylspiro[1H-indole-3,2'-oxane]-2-one (PubChem CID 118340195) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is (4'R,6'S)-4'-hydroxy-4'-prop-2-enyl-6'-propylspiro[1H-indole-3,2'-oxane]-2-one.
| Compound Name | (4'R,6'S)-4'-hydroxy-4'-prop-2-enyl-6'-propylspiro[1H-indole-3,2'-oxane]-2-one |
|---|---|
| PubChem CID | 118340195 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (4'R,6'S)-4'-hydroxy-4'-prop-2-enyl-6'-propylspiro[1H-indole-3,2'-oxane]-2-one |
| SMILES | C=CC[C@@]1(O)C[C@H](CCC)OC2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C18H23NO3/c1-3-7-13-11-17(21,10-4-2)12-18(22-13)14-8-5-6-9-15(14)19-16(18)20/h4-6,8-9,13,21H,2-3,7,10-12H2,1H3,(H,19,20)/t13-,17+,18?/m0/s1 |
| InChIKey | PHUXAHGOPJZSFW-DQAFQZJZSA-N |
| XLogP | 3.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|