C16H15NO3 — CID 123642276
6'-but-3-ynylspiro[1H-indole-3,2'-oxane]-2,4'-dione (PubChem CID 123642276) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 6'-but-3-ynylspiro[1H-indole-3,2'-oxane]-2,4'-dione.
| Compound Name | 6'-but-3-ynylspiro[1H-indole-3,2'-oxane]-2,4'-dione |
|---|---|
| PubChem CID | 123642276 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 6'-but-3-ynylspiro[1H-indole-3,2'-oxane]-2,4'-dione |
| SMILES | C#CCCC1CC(=O)CC2(O1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C16H15NO3/c1-2-3-6-12-9-11(18)10-16(20-12)13-7-4-5-8-14(13)17-15(16)19/h1,4-5,7-8,12H,3,6,9-10H2,(H,17,19) |
| InChIKey | WVUJUKPXHBQIRL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|