C16H13NO2 — CID 166063555
spiro[1H-indole-3,2'-3,4-dihydrochromene]-2-one (PubChem CID 166063555) has the molecular formula C16H13NO2 and a molecular weight of 251.29 g/mol. Its IUPAC name is spiro[1H-indole-3,2'-3,4-dihydrochromene]-2-one.
| Compound Name | spiro[1H-indole-3,2'-3,4-dihydrochromene]-2-one |
|---|---|
| PubChem CID | 166063555 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | spiro[1H-indole-3,2'-3,4-dihydrochromene]-2-one |
| SMILES | O=C1Nc2ccccc2C12CCc1ccccc1O2 |
| InChI | InChI=1S/C16H13NO2/c18-15-16(12-6-2-3-7-13(12)17-15)10-9-11-5-1-4-8-14(11)19-16/h1-8H,9-10H2,(H,17,18) |
| InChIKey | GEANSAHNOWOCKI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |