C11H10N2O2 — CID 140764521
2'-iminospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-4'-one (PubChem CID 140764521) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2'-iminospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-4'-one.
| Compound Name | 2'-iminospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-4'-one |
|---|---|
| PubChem CID | 140764521 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2'-iminospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-4'-one |
| SMILES | [H]/N=C1\NC(=O)C2(CCc3ccccc32)O1 |
| InChI | InChI=1S/C11H10N2O2/c12-10-13-9(14)11(15-10)6-5-7-3-1-2-4-8(7)11/h1-4H,5-6H2,(H2,12,13,14) |
| InChIKey | GSLXBWXDEDBPNI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|