C15H19N3O — CID 138389883
4'-imino-1'-propan-2-ylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2'-one (PubChem CID 138389883) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 4'-imino-1'-propan-2-ylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2'-one.
| Compound Name | 4'-imino-1'-propan-2-ylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2'-one |
|---|---|
| PubChem CID | 138389883 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 4'-imino-1'-propan-2-ylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2'-one |
| SMILES | [H]/N=C1\NC(=O)N(C(C)C)C12CCCc1ccccc12 |
| InChI | InChI=1S/C15H19N3O/c1-10(2)18-14(19)17-13(16)15(18)9-5-7-11-6-3-4-8-12(11)15/h3-4,6,8,10H,5,7,9H2,1-2H3,(H2,16,17,19) |
| InChIKey | NNSBDIKWDOVGET-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|