C16H21N3O — CID 138389056
4'-imino-1'-propylspiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2'-one (PubChem CID 138389056) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 4'-imino-1'-propylspiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2'-one.
| Compound Name | 4'-imino-1'-propylspiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2'-one |
|---|---|
| PubChem CID | 138389056 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4'-imino-1'-propylspiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2'-one |
| SMILES | [H]/N=C1\NC(=O)N(CCC)C12CCCCc1ccccc12 |
| InChI | InChI=1S/C16H21N3O/c1-2-11-19-15(20)18-14(17)16(19)10-6-5-8-12-7-3-4-9-13(12)16/h3-4,7,9H,2,5-6,8,10-11H2,1H3,(H2,17,18,20) |
| InChIKey | ILIHMIMOJRTANB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|