C16H21N3O2 — CID 138391204
4'-imino-2,2-dimethyl-1'-propylspiro[3H-chromene-4,5'-imidazolidine]-2'-one (PubChem CID 138391204) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4'-imino-2,2-dimethyl-1'-propylspiro[3H-chromene-4,5'-imidazolidine]-2'-one.
| Compound Name | 4'-imino-2,2-dimethyl-1'-propylspiro[3H-chromene-4,5'-imidazolidine]-2'-one |
|---|---|
| PubChem CID | 138391204 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4'-imino-2,2-dimethyl-1'-propylspiro[3H-chromene-4,5'-imidazolidine]-2'-one |
| SMILES | [H]/N=C1\NC(=O)N(CCC)C12CC(C)(C)Oc1ccccc12 |
| InChI | InChI=1S/C16H21N3O2/c1-4-9-19-14(20)18-13(17)16(19)10-15(2,3)21-12-8-6-5-7-11(12)16/h5-8H,4,9-10H2,1-3H3,(H2,17,18,20) |
| InChIKey | SDCOETPLVVYSAR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|